Giáo DụcLớp 12

Bài tập về Este đa chức

Este đa chức là những este chứa ít nhất 2 nhóm chức -COO- trong phân tử. Thông thường số chức este là bội số chung nhỏ nhất của số chức axit và số chức ancol trừ trường hợp tạo polime.

Trong bài viết dưới đây THPT Số 2 Đức Phổ sẽ giới thiệu đến các bạn các dạng bài tập của Este đa chức. Tài liệu bao gồm công thức tổng quát, phản ứng xà phòng hóa, ví dụ minh họa kèm theo các dạng bài tập có đáp án chi tiết. Qua đó giúp các bạn lớp 12 có thêm nhiều tư liệu tham khảo, trau dồi kiến thức để nhanh chóng biết cách giải các bài tập Hóa học 12.

Bạn đang xem: Bài tập về Este đa chức

1. Công thức tổng quát của Este đa chức

Este tạo thành từ axit đơn chức và ancol đa chức (n chức): (RCOO)nR’ Este tạo thành từ axit đa chức (n chức) và ancol đơn chức: R(COOR’)n

Este tạo thành từ axit đa chức (n chức) và ancol đa chức (m chức): Rm(COO)m.nR’n

Khi n = m thành R(COO)nR’ ⇒ este vòng

Este no, 2 chức, mạch hở: CnH2n-2O4

2. Phản ứng xà phòng hóa

mathrm{x}=frac{mathrm{n}_{mathrm{NaOH}}}{mathrm{n}_{text {este_ }}} ⇒ x là số nhóm chức este

– Khi xà phòng hóa este 2 chức với dung dịch NaOH cho:

1 muối + 1 ancol + 1 anđehit thì este đó có cấu tạo: R1 – OOC-R-COO-CH=CH-R2

R1-OOC-R-COO-CH=CH-R2 + 2NaOH overset{t^{o} }{rightarrow} NaOOC-R-COONa + R1OH + R2CH2CHO

2 muối + 1 ancol thì este đó có cấu tạo: R1 – COO-R-OOC-R2

R1 – COO-R-OOC-R2 + 2NaOH overset{t^{o} }{rightarrow} R1 – COONa + R2COONa + R(OH)2

Ta có: nOH- = 2neste= Σnmuối; nancol= neste

1 muối + 2 ancol thì este đó có cấu tạo: R1OOC-R-COOR2

Phản ứng:

R 1 -OOC-R-COOR 2 + 2NaOH overset{t^{o} }{rightarrow} NaOOC-R-COONa + R 1 OH + R 2 OH

Ta có: nOH-= 2nmuối= 2neste; nOH- = 2 Σnrượu.

1 muối + 1 ancol thì este đó có cấu tạo: R(COOR’)2 hoặc (RCOO)2R’

Phản ứng:

R(COOR’)2 + 2NaoH overset{t^{o} }{rightarrow} NaOOC-R-COONa + 2R’OH

(RCOO)2R’ + 2NaOH overset{t^{o} }{rightarrow} 2RCOONa + R'(OH)2

3. Ví dụ về Este đa chức

Ví dụ 1. Hợp chất hữu cơ X chứa một loại nhóm chức có CTPT là C8H14O4. Khi thủy phân X trong dung dịch NaOH thu được một muối và hỗn hợp hai ancol A và B. Phân tử ancol B có số nguyên tử cacbon nhiều gấp đôi trong A. Khi đun nóng với H2SO4 đặc, A cho một anken và B cho 2 anken. Tìm CTCT của X

Gợi ý đáp án

X + NaOH → 1 muối + 2 ancol => X: R1OOC-R-COOR2

A, B đều tạo ra anken => A, B phải có ít nhất 2 nguyên tử C

X có 8C, có 2 nhóm –COO, B có số C gấp đôi số C của A => A có 2C (C2H5OH) và B có 4C (C4H9OH) có CTCT: CH3-CHOH-CH2CH3

Axít tạo ra este là axit oxalic: HOOC-COOH

Ví dụ 2: Chất A có CTPT là C11H20O4. A tác dụng với NaOH tạo ra muối của axit hữu cơ B mạch thẳng và 2 ancol là etanol và propanol-2. Hãy viết CTCT của A.

Gợi ý đáp án

A: C11H20O4 + NaOH muối + C2H5OH + CH3-CHOH-CH3

⇒ A là este tạo nên từ axit no 2 chức và 2 ancol trên

⇒ CTCT của A là: C2H5OOC-CH2-CH2-CH2-CH2-COO-CH-(CH3)2

Ví dụ 3: Để thủy phân 0,1 mol este A chỉ chứa 1 loại nhóm chức cần dùng vừa đủ 100gam dd NaOH 12%, thu được 20,4 gam muối của một axit hữu cơ và 9,2 gam một ancol. Xác định CTPT, viết CTCT và gọi tên este đó. Biết 1 trong 2 chất (ancol hoặc axit) tạo thành este là đơn chức

Gợi ý đáp án

nX : nNaOH= 1 : 3

Do ancol đa chức và muối của axit hữu cơ

⇒ X là este 3 chức (RCOO)3R’

⇒ nancol= nX= 0,1 mol ⇒ Mancol = R’ + 17 × 3 = 92 ⇒ R = 41 (C3H5)

mmuối= 3nX = 0,3 mol ⇒ Mmuối= R + 67 = 68 ⇒ R = 1 (H)

X là (HCOO)3C3H5: Glixerol trifomiat

Ví dụ 4: Để thuỷ phân hết 7,612 gam hỗn hợp X gồm 2 este đơn chức và 2 este đa chức thì cần dùng vừa hết 80ml dung dịch KOH aM. Sau phản ứng, thu được hỗn hợp Y gồm các muối của các axit cacboxylic và các ancol. Đốt cháy hoàn toàn hỗn hợp Y thì thu được K2CO3, 4,4352 lít CO2 (đktc) và 3,168 gam H2O. Vậy a có giá trị là bao nhiêu?

Gợi ý đáp án

Thủy phân: 7,612 gam X + 2x mol KOH → Y (gồm cả muối + ancol).

Đốt Y + O2 → x mol K2CO3 + 0,198 mol CO2 + 0,176 mol H2O.

+ Bảo toàn C có nC trong X = nC trong Y= 0,198 + x mol.

+ Bảo toàn H có nH trong X = nH trong Y – nH trong KOH= 0,352 – 2x mol.

+ O trong X theo cụm –COO mà n–COO = nKOH= 2x mol → nO trong X= 4x mol.

Tổng lại: mX= mC+ mH+ mO = 7,612 gam. Thay vào giải x = 0,066 mol.

→ nKOH = 2x = 0,132 mol → a = 0,132 : 0,08 = 1,65M.

Ví dụ 5. Cho 0,01 mol một este X của axit hữu cơ phản ứng vừa đủ với 100 ml dung dịch NaOH 0,2 M, sản phẩm tạo thành chỉ gồm một ancol Y và một muối Z với số mol bằng nhau. Mặt khác, khi xà phòng hoá hoàn toàn 1,29 gam este đó bằng một lượng vừa đủ là 60 ml dung dịch KOH 0,25 M, sau khi phản ứng kết thúc đem cô cạn dung dịch được 1,665 gam muối khan. Công thức của este X là:

A. C2H4(COO)2C4H8

B. C4H8(COO)2C2H4

C. C2H4(COOC4H9)2

D. C4H8(COOC2H5)2

Gợi ý đáp án

Ta có: nZ = nY ⇒ X chỉ chứa chức este

Sỗ nhóm chức este là: nNaOH/nX = (0,1.0,2)/0,01 = 2 => CT của X có dạng: R(COO)2R’

Từ phản ứng thủy phân: naxit = nmuối = 1/2 nKOH = 1/2.0,06.0,25 = 0,0075 mol

M este = 1,29/0,0075 = 172 => 172 => R + 2,44 + R’ = 172 => R’ = 28

Vậy X C4H8(COO)2C2H4

Đáp án B

4. Bài tập về Este

Câu 1. Khi thủy phân hoàn toàn 0,05 mol este tiêu tốn hết 5,6 gam KOH. Mặt khác, khi thủy phân 5,475 gam este đó thì tiêu tốn hết 4,2 gam KOH và thu được 6,225 gam muối. Vậy CTCT este là:

A. (COOC2H5)2

B. (COOCH3)2

C. (COOCH2CH2CH3)2

D. Kết quả khác

nKOH =0,1 mol

0,0375 mol este khi thủy phân cần 4,2 g KOH

⇒ Meste = (5,475 : 0,0375) = 146 (g/mol)

Là este 2 chức nên (COOCH2CH2CH3)2 và CH(COOCH3)3 sai.

Muối là (RCOOK)2 nmuối = neste= 0,0375 (mol)

⇒ Mmuối= R + 166 = (6,225: 0,0375) =166(g/mol)

⇒ R = 0 và axit là HOOC-COOH

Meste= 146 ⇒ gốc ancol 2R = 146 – 88 = 58 ⇒ R = 29 hay C2H5

Vậy este là (COOC2H5)2

Câu 2. Đốt cháy a mol X là trieste của glixerol với axit đơn chức mạch hở thu được b mol CO2 và c mol H2O, biết b – c = 4a. Hiđro hóa m gam X cần 6,72 lít H2 (đktc) thu được 39 gam một sản phẩm. Nếu đun m gam X với dung dịch chứa 0,7 mol NaOH đến phản ứng hoàn toàn, cô cạn dung dịch sau phản ứng thu được chất rắn khan có khối lượng là

A. 57,2 gam

B. 52,6 gam

C. 61,48 gam

D. 53,2 gam

Nhận thấy b-c= 4a → trong X có 5 liên kết π trong đó có 3 liên kết π ở gốc COO và 2 liên kết π ở gốc hidrocacbon C=C

Như vậy để hidro hóa hoàn toàn 1 mol X cần dùng 2 mol H2

→ nX = 0,3 : 2 = 0,15 mol

Bảo toàn khối lương → mX = 39 – 0,3. 2= 38,4 gam

Khi tham gia phản ứng thủy phân → nC3H5(OH)3 = nX = 0,15 mol

Bảo toàn khối lượng → mchất rắn= mX + mNaOH– mC3H5(OH)3

→ mchất rắn = 38,4 + 0,7. 40 – 0,15. 92 = 52,6 gam.

Đáp án B.

Câu 3. Este X được tạo thành từ etylen glicol và hai axit cacboxylic đơn chức. Trong phân tử este, số nguyên tử cacbon nhiều hơn số nguyên tử oxi là 1. Khi cho m gam X tác dụng với dung dịch NaOH (dư) thì lượng NaOH đã phản ứng là 10 gam. Giá trị của m là

A. 14,5.

B. 17,5.

C. 15,5.

D. 16,5.

Gọi công thức của X là (RCOO)2C2H4

Phân tích: Trong phân tử este, số nguyên tử cacbon nhiều hơn số nguyên tử oxi là 1. Vậy nên trong phân tử este có 5C. Mà nhìn vào CT của X ta đã thấy 4C nên CT của X là HCOOC2H4OOCCH3 .

Vì este này là 2 chức nên:

mathrm{n}_{text {este }}=frac{1}{2} mathrm{n}_{mathrm{NaOH}}=frac{1}{2} cdot frac{10}{40}=0,125 mathrm{~mol}

Vậy khối lượng m là: m = 0,125.132 = 16,5g

Câu 4. Cho axit salixylic (axit o-hiđroxibenzoic) phản ứng với anhiđrit axetic, thu được axit axetylsalixylic (o-CH3COO-C6H4-COOH) dùng làm thuốc cảm (aspirin). Để phản ứng hoàn toàn với 43,2 gam axit axetylsalixylic cần vừa đủ V lít dung dịch KOH 1M. Giá trị của V là

A.0,72.

B. 0,24.

C. 0,48.

D. 0,96.

naxit = 0,24 mol

nKOH= 3naxit= 0,72 mol

Rightarrow mathrm{V}_{mathrm{KOH}}=frac{0,72}{1}=0,72 mathrm{lit}

Câu 5. Xà phòng hóa hoàn toàn 1 este X đa chức với 100ml dung dịch KOH 1M sau phản ứng cô cạn dung dịch thu được 8,32 gam chất rắn và ancol đơn chức Y. Nếu đốt cháy hoàn toàn Y thu được 3,584 lit CO2 (đktc) và 4,32 gam H2O công thúc cấu tạo của X là

A. C2H5OOC-C2H4-COOC2H5

B. CH3COOCH2-CH2-OOCCH3

C. C2H5OOC-CH2-COOC2H5

D. CH3OOC-C2H4-COOCH3

n_{CO_2} = 0,16 mol; n_{H_2O} = 0,24 mol ⇒ nY= 0,08 mol

⇒ C2H6O ⇒ Loại B, D

⇒ nX= 0,04 mol ⇒ mX = 8,32 + 0,08.46 – 0,1.56 = 6,4

⇒ MX = 160

⇒ C2H5OOC-CH2-COOC2H5 ⇒ Đáp án C

Câu 6. Hai este A và B là dẫn xuất của benzen có công thức phân tử là C9H8O2. A và B đều cộng hợp với Br2 tỉ lệ mol 1 : 1. A tác dụng với dung dịch NaOH cho 1 muối và 1 andehit. B tác dụng với dung dịch NaOH dư cho 2 muối và H2O. Công thức cấu tạo của A và B lần lượt là:

A. HOOC-C6H4-CH=CH2 và CH2=CH-COOC6H5.

B. C6H5COOCH=CH2 và C6H5-CH=CH-COOH.

C. HOOC-C6H4-CH=CH2 và HCOOCH=CH-C6H5.

D. C6H5COOCH-CH2 và CH2=CH-COOC6H5.

A, B đều phản ứng cộng với Br2 tỉ lệ mol 1 : 1 ⇒ có 1 liên kết C=C.

A + NaOH → muối + andehit ⇒ A là este với gốc hidrocacbon anco có liên kết C=C gắn với -COO- dạng RCOO-CH=CH-R’.

⇒ Loại A.

B + NaOH dư → 2 muối và H2O ⇒ B là este của phenol RCOO-C6H4-R’.

Câu 7. Đốt cháy hết a gam C2H5OH thu được 0,25 mol CO2. Đốt cháy hết b gam CH3COOH thu được 0,25 mol CO2. Cho a gam C2H5OH tác dụng với b gam CH3COOH (giả sử hiệu suất phản ứng là 100%). Khối lượng este thu được là

A. 9 gam

B. 10 gam.

C. 11 gam

D. 12 gam.

Gợi ý đáp án

Phương trình đốt cháy

C2H5OH + 3O2 → 2CO2 + 3H2O

0,125 mol ← 0,25 mol

CH3COOH + O2 → 2CO2 + 2H2O

0,125 mol ← 0,25 mol

Cả hai chất đều đủ do tỉ lệ 1:1 nên tính khối lượng este theo chất nào cũng được

C2H5OH + CH3COOH ⇔ CH3COOC2H5 + H2O

0,125 → 0,125

Khối lượng este tạo thành là:

meste = neste.M = 0,125. 88 =11 (gam)3

Đăng bởi: THPT Số 2 Đức Phổ

Chuyên mục: Giáo dục, Lớp 12

Trả lời

Email của bạn sẽ không được hiển thị công khai.

Back to top button

Bạn đang dùng trình chặn quảng cáo!

Bạn đang dùng trình chặn quảng cáo!